Surfak

Molecular Formula: C40H74CaO14S2


InChI: InChI=1/2C20H38O7S.Ca/c2*1-5-9-11-16(7-3)14-26-19(21)13-18(28(23,24)25)20(22)27-15-17(8-4)12-10-6-2;/h2*16-18H,5-15H2,1-4H3,(H,23,24,25);/q;;+2/p-2/f2C20H37O7S.Ca/q2*-1;m

InChIKey: InChIKey=DWKPZOZZBLWFJX-CICXOJNKCQ
SMILES: CCCCC(CC)COC(=O)CC(C(=O)OCC(CC)CCCC)S(=O)(=O)[O-].CCCCC(CC)COC(=O)CC(C(=O)OCC(CC)CCCC)S(=O)(=O)[O-].[Ca+2]

Names:
    Butanedioic acid, sulfo-, 1,4-bis(2-ethylhexyl) ester, calcium salt
    calcium 1,2-bis(2-ethylhexoxycarbonyl)ethanesulfonate
    Calcium 1,4-bis(2-ethylhexyl) bis(2-sulphosuccinate)
    Dioctyl calcium sulfosuccinate
    Docusate Calcium [USAN]
    DOCUSATE CALCIUM
    Doxidan
    EINECS 204-889-8
    Surfak
    1,4-Bis(2-ethylhexyl) sulfosuccinate, calcium salt
    128-49-4

Registries:
    PubChem CID 31407
    PubChem ID 173484