Reduced glutathione

[(Science: biochemistry) The tripeptide _ glutamylcysteinylglycine. It contains an unusual peptide Linkage between the _ carboxyl group of the glutamate side chain and the amine group of cysteine. The concentration of glutathione in animal cells is _5mM and its sulphydryl group is kept largely in the reduced state. this allows it to act as a sulphydryl buffer, reducing any disulphide bonds formed within cytoplasmic proteins to cysteines. Hence, few, if any, cytoplasmic proteins contain disulphide bonds. glutathione is also important as a cofactor for the enzyme glutathione peroxidase, in the uptake of amino acids and participates in leucotriene synthesis.

[1. Abbreviation for glutathione.

Molecular Formula: C₁₀H₁₇N₃O₆S

InChI: InChI=1/C10H17N3O6S/c11-5(10(18)19)1-2-7(14)13-6(4-20)9(17)12-3-8(15)16/h5-6,20H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19)/t5-,6-/m0/s1/f/h12-13,15,18H

InChIKey: InChIKey=RWSXRVCMGQZWBV-VSCBVDDUDG
SMILES: N[C@@H](CCC(=O)N[C@@H](CS)C(=O)NCC(O)=O)C(O)=O

CAS number 70-18-8

Names:
    gamma-L-Glutamyl-L-cysteinyl-glycine
    Glutathione
    glutathione
    Glutathione
    GLUTATHIONE
    glutathione
    GSH
    N-(N-gamma-L-Glutamyl-L-cysteinyl)glycine
    Reduced glutathione
    γ-L-glutamyl-L-cysteinyl-glycine
    (2S)-2-amino-4-[[(1S)-1-(carboxymethylcarbamoyl)-2-sulfanyl-ethyl]carbamoyl]butanoic acid
    5-L-Glutamyl-L-cysteinylglycine

Registries:
    PubChem CID 124886
    CAS 70-18-8 (from NIST)
    ChEBI 16856
    chemPDB GSH
    Kegg C00051
    PubChem ID 10241198
    PubChem ID 3353