Hydrocortisone

[(Science: hormone) The major adrenal glucocorticoid, stimulates conversion of proteins to carbohydrates, raises blood sugar levels and promotes glycogen storage in the liver.

[1. The principal glucocorticoid produced by the zona fasciculata of the adrenal cortex. It promotes gluconeogenesis and lipolysis, suppresses protein synthesis, inhibits inflammatory and immune responses, and has mild mineralocorticoid (hypernatremic, kaliureteric, antidiuretic) effects. Most plasma cortisol is bound to transcortin and albumin. Synthetic cortisol administered as a drug is usually known by the alternative name hydrocortisone.

Molecular Formula: C₂₁H₃₀O₅

InChI: InChI=1/C21H30O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h9,14-16,18,22,24,26H,3-8,10-11H2,1-2H3/t14-,15-,16-,18+,19-,20-,21-/m0/s1

InChIKey: InChIKey=JYGXADMDTFJGBT-VWUMJDOOBO
SMILES: [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])[C@@H](O)C[C@@]4(C)[C@@]2([H])CC[C@]4(O)C(=O)CO

CAS number 50-23-7

Names:
    Cortisol
    cortisol
    Cortisol
    cortisol
    Hydrocortisone
    Kendall's compound F
    Prestwick0_000447
    Reichstein's substance M
    (11β)-11,17,21-trihydroxypregn-4-ene-3,20-dione
    (8R,9R,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one
    11beta,17alpha,21-Trihydroxy-4-pregnene-3,20-dione
    11β,17α,21-trihydroxy-4-pregnene-3,20-dione
    11β-hydrocortisone
    17-hydroxycorticosterone
    4-pregnen-11β,17α,21-triol-3,20-dione

Registries:
    PubChem CID 5754
    Beilstein =1354819
    CAS 50-23-7 (from NIST)
    ChEBI 17650
    Kegg C00735
    PubChem ID 11466475
    PubChem ID 3998