vitamin M

[(Science: biochemistry) molecule that acts as a carrier of one carbon units in intermediary metabolism. It contains residues of p aminobenzoate, glutamate and a substituted pteridine. The latter cannot be synthesised by mammals, which must obtain tetrahydrofolate as a vitamin or from intestinal microorganisms. One carbon units are carried at three different levels of oxidation, as methyl, methylene or formimino groups. Important biosyntheses dependent on tetrahydrofolate include those of methionine, thymine and purines. analogues of dihydrofolate, such as aminopterin and methotrexate block the action of tetrahydrofolate by inhibiting its regeneration from dihydrofolate. a B vitamin that is essential for cell growth and reproduction.

[1. A collective term for pteroylglutamic acids and their oligoglutamic acid conjugates. N-[p-[[(2-Amino-4-hydroxypteridin-6- yl)methyl

InChI: InChI=1/C19H19N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,8,12,21H,5-7H2,(H,24,29)(H,27,28)(H,31,32)(H3,20,22,25,26,30)/t12-/m0/s1/f/h24,26-27,31H,20H2

InChIKey: InChIKey=OVBPIULPVIDEAO-SDUCKQNDDW
SMILES: NC1=Nc2ncc(CNc3ccc(cc3)C(=O)N[C@@H](CCC(O)=O)C(O)=O)nc2C(=O)N1

CAS number 59-30-3

Names:
    Folate
    Folic acid
    folic acid
    Folsäure
    N-pteroyl-L-glutamic acid
    PGA
    PteGlu
    Pteroylglutamic acid
    pteroyl-L-glutamic acid
    pteroyl-L-monoglutamic acid
    vitamin Bc
    vitamin M

Registries:
    PubChem CID 6037
    Beilstein =100781
    CAS 59-30-3 (from NIST)
    ChEBI 27470
    chemPDB FOL
    Kegg C00504
    PubChem ID 3787