cis-inositol


InChI: InChI=1/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H/t1-,2+,3-,4+,5-,6+

InChIKey: InChIKey=CDAISMWEOUEBRE-JMVOWJSSBA
SMILES: O[C@H]1[C@@H](O)[C@@H](O)[C@@H](O)[C@@H](O)[C@H]1O

Names:
    cis-inositol
    (1s,2s,3s,4s,5s,6s)-cyclohexane-1,2,3,4,5,6-hexol
    1,2,3,4,5,6/0-cyclohexanetetrol

Registries:
    ChemSpider: InChIKey=CDAISMWEOUEBRE-JMVOWJSSBA
    PubChem CID 892
    ChEBI 23311


Google
 
Web sci-toys.com