L-Lactic acid


InChI: InChI=1/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6)/t2-/m0/s1

InChIKey: InChIKey=JVTAAEKCZFNVCJ-REOHCLBHBP
SMILES: C[C@H](O)C(O)=O

CAS number 79-33-4

Names:
    L-Lactate
    L-Lactic acid
    L-Milchsäure
    L-(+)-lactic acid
    L-(+)-α-hydroxypropionic acid
    (S)-Lactate
    (S)-lactic acid
    (S)-(+)-lactic acid
    (S)-2-hydroxypropanoic acid
    (S)-2-hydroxypropionic acid
    (+)-lactic acid

Registries:
    ChemSpider: InChIKey=JVTAAEKCZFNVCJ-REOHCLBHBP
    PubChem CID 107689
    Beilstein =1720251
    CAS 79-33-4 (from NIST)
    ChEBI 422
    Gmelin 362717
    Kegg C00186
    PubChem ID 3486


Google
 
Web sci-toys.com